C24H28N4O4 — CID 166191316
3-methyl-N-[3-[(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)amino]cyclobutyl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide (PubChem CID 166191316) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-methyl-N-[3-[(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)amino]cyclobutyl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide.
| Compound Name | 3-methyl-N-[3-[(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)amino]cyclobutyl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 166191316 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-methyl-N-[3-[(3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carbonyl)amino]cyclobutyl]-4-oxo-1,5,6,7-tetrahydroindole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC(NC(=O)c3[nH]c4c(c3C)C(=O)CCC4)C2)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C24H28N4O4/c1-11-19-15(5-3-7-17(19)29)27-21(11)23(31)25-13-9-14(10-13)26-24(32)22-12(2)20-16(28-22)6-4-8-18(20)30/h13-14,27-28H,3-10H2,1-2H3,(H,25,31)(H,26,32) |
| InChIKey | IHGTZJTWIYHOBS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |