C22H27NO3 — CID 166191419
2-(2-benzylphenoxy)-1-[4-(hydroxymethyl)piperidin-1-yl]propan-1-one (PubChem CID 166191419) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-(2-benzylphenoxy)-1-[4-(hydroxymethyl)piperidin-1-yl]propan-1-one.
| Compound Name | 2-(2-benzylphenoxy)-1-[4-(hydroxymethyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 166191419 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-(2-benzylphenoxy)-1-[4-(hydroxymethyl)piperidin-1-yl]propan-1-one |
| SMILES | CC(Oc1ccccc1Cc1ccccc1)C(=O)N1CCC(CO)CC1 |
| InChI | InChI=1S/C22H27NO3/c1-17(22(25)23-13-11-19(16-24)12-14-23)26-21-10-6-5-9-20(21)15-18-7-3-2-4-8-18/h2-10,17,19,24H,11-16H2,1H3 |
| InChIKey | YEDJFTZZJLALIT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |