C15H15N3O2S — CID 166192357
N-[1-(1,3-thiazole-5-carbonyl)pyrrolidin-3-yl]benzamide (PubChem CID 166192357) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[1-(1,3-thiazole-5-carbonyl)pyrrolidin-3-yl]benzamide.
| Compound Name | N-[1-(1,3-thiazole-5-carbonyl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 166192357 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[1-(1,3-thiazole-5-carbonyl)pyrrolidin-3-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2cncs2)C1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3O2S/c19-14(11-4-2-1-3-5-11)17-12-6-7-18(9-12)15(20)13-8-16-10-21-13/h1-5,8,10,12H,6-7,9H2,(H,17,19) |
| InChIKey | UPYKNNBXUJVEAD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |