C18H15BrN6S — CID 166194522
N-[5-(4-bromophenyl)thieno[2,3-d]pyrimidin-4-yl]-N'-pyrimidin-2-ylethane-1,2-diamine (PubChem CID 166194522) has the molecular formula C18H15BrN6S and a molecular weight of 427.33 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)thieno[2,3-d]pyrimidin-4-yl]-N'-pyrimidin-2-ylethane-1,2-diamine.
| Compound Name | N-[5-(4-bromophenyl)thieno[2,3-d]pyrimidin-4-yl]-N'-pyrimidin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 166194522 |
| Molecular Formula | C18H15BrN6S |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-[5-(4-bromophenyl)thieno[2,3-d]pyrimidin-4-yl]-N'-pyrimidin-2-ylethane-1,2-diamine |
| SMILES | Brc1ccc(-c2csc3ncnc(NCCNc4ncccn4)c23)cc1 |
| InChI | InChI=1S/C18H15BrN6S/c19-13-4-2-12(3-5-13)14-10-26-17-15(14)16(24-11-25-17)20-8-9-23-18-21-6-1-7-22-18/h1-7,10-11H,8-9H2,(H,20,24,25)(H,21,22,23) |
| InChIKey | LBKGYATWAGYEFX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|