C17H22F6N6O — CID 166195248
1,4-bis[[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]methyl]-1,4-diazepan-6-ol (PubChem CID 166195248) has the molecular formula C17H22F6N6O and a molecular weight of 440.39 g/mol. Its IUPAC name is 1,4-bis[[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]methyl]-1,4-diazepan-6-ol.
| Compound Name | 1,4-bis[[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]methyl]-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 166195248 |
| Molecular Formula | C17H22F6N6O |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1,4-bis[[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]methyl]-1,4-diazepan-6-ol |
| SMILES | Cn1ncc(CN2CCN(Cc3cnn(C)c3C(F)(F)F)CC(O)C2)c1C(F)(F)F |
| InChI | InChI=1S/C17H22F6N6O/c1-26-14(16(18,19)20)11(5-24-26)7-28-3-4-29(10-13(30)9-28)8-12-6-25-27(2)15(12)17(21,22)23/h5-6,13,30H,3-4,7-10H2,1-2H3 |
| InChIKey | FQCSGRFZDCMUIG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |