C24H30N4O5S — CID 166195527
5-[4-[2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]piperazin-1-yl]sulfonyl-1,3-dihydrobenzimidazol-2-one (PubChem CID 166195527) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is 5-[4-[2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]piperazin-1-yl]sulfonyl-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[4-[2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]piperazin-1-yl]sulfonyl-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 166195527 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 5-[4-[2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propyl]piperazin-1-yl]sulfonyl-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N3CCN(CC(O)COC4CCCc5ccccc54)CC3)cc2[nH]1 |
| InChI | InChI=1S/C24H30N4O5S/c29-18(16-33-23-7-3-5-17-4-1-2-6-20(17)23)15-27-10-12-28(13-11-27)34(31,32)19-8-9-21-22(14-19)26-24(30)25-21/h1-2,4,6,8-9,14,18,23,29H,3,5,7,10-13,15-16H2,(H2,25,26,30) |
| InChIKey | IYLOINGVQCMBDT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |