C20H34N4O6 — CID 166196584
N-methyl-2-[2-[2-[methyl-(2-oxoazepan-3-yl)amino]-2-oxoethoxy]ethoxy]-N-(2-oxoazepan-3-yl)acetamide (PubChem CID 166196584) has the molecular formula C20H34N4O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-methyl-2-[2-[2-[methyl-(2-oxoazepan-3-yl)amino]-2-oxoethoxy]ethoxy]-N-(2-oxoazepan-3-yl)acetamide.
| Compound Name | N-methyl-2-[2-[2-[methyl-(2-oxoazepan-3-yl)amino]-2-oxoethoxy]ethoxy]-N-(2-oxoazepan-3-yl)acetamide |
|---|---|
| PubChem CID | 166196584 |
| Molecular Formula | C20H34N4O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-methyl-2-[2-[2-[methyl-(2-oxoazepan-3-yl)amino]-2-oxoethoxy]ethoxy]-N-(2-oxoazepan-3-yl)acetamide |
| SMILES | CN(C(=O)COCCOCC(=O)N(C)C1CCCCNC1=O)C1CCCCNC1=O |
| InChI | InChI=1S/C20H34N4O6/c1-23(15-7-3-5-9-21-19(15)27)17(25)13-29-11-12-30-14-18(26)24(2)16-8-4-6-10-22-20(16)28/h15-16H,3-14H2,1-2H3,(H,21,27)(H,22,28) |
| InChIKey | GZOCIGCTXQPRRG-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|