C21H29NO2 — CID 166197123
6-[1-[4-(2-methoxyphenyl)phenyl]ethylamino]hexan-3-ol (PubChem CID 166197123) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 6-[1-[4-(2-methoxyphenyl)phenyl]ethylamino]hexan-3-ol.
| Compound Name | 6-[1-[4-(2-methoxyphenyl)phenyl]ethylamino]hexan-3-ol |
|---|---|
| PubChem CID | 166197123 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 6-[1-[4-(2-methoxyphenyl)phenyl]ethylamino]hexan-3-ol |
| SMILES | CCC(O)CCCNC(C)c1ccc(-c2ccccc2OC)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-4-19(23)8-7-15-22-16(2)17-11-13-18(14-12-17)20-9-5-6-10-21(20)24-3/h5-6,9-14,16,19,22-23H,4,7-8,15H2,1-3H3 |
| InChIKey | IPYKQGPUHJDWDJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|