C18H16N2O4 — CID 166197825
3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 166197825) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166197825 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(c2cccc3c2OCCO3)C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C18H16N2O4/c1-19-15(12-6-3-2-4-7-12)17(21)20(18(19)22)13-8-5-9-14-16(13)24-11-10-23-14/h2-9,15H,10-11H2,1H3 |
| InChIKey | XPRGNMCMPGEFCG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|