C19H22N6O — CID 166197984
N-[(4-imidazol-1-ylphenyl)methyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxamide (PubChem CID 166197984) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[(4-imidazol-1-ylphenyl)methyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N-[(4-imidazol-1-ylphenyl)methyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 166197984 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-[(4-imidazol-1-ylphenyl)methyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccc(-n2ccnc2)cc1)N1CCCC(c2ccn[nH]2)C1 |
| InChI | InChI=1S/C19H22N6O/c26-19(24-10-1-2-16(13-24)18-7-8-22-23-18)21-12-15-3-5-17(6-4-15)25-11-9-20-14-25/h3-9,11,14,16H,1-2,10,12-13H2,(H,21,26)(H,22,23) |
| InChIKey | FFXKMIRMGYQVRE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |