About 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate
3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate (PubChem CID 166199225) has the molecular formula C18H16ClFN4O2
and a molecular weight of 374.80 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate.
Molecular Properties
| Compound Name | 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate |
| PubChem CID | 166199225 |
| Molecular Formula | C18H16ClFN4O2 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCCCc2ccncc2)nnn1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClFN4O2/c1-12-17(18(25)26-10-2-3-13-6-8-21-9-7-13)22-23-24(12)14-4-5-16(20)15(19)11-14/h4-9,11H,2-3,10H2,1H3 |
| InChIKey | OXBGRFUOVQJYFT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate?
The IUPAC name of 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate (CID 166199225) is 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate.
What is the SMILES notation for 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate?
The canonical SMILES for 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate is Cc1c(C(=O)OCCCc2ccncc2)nnn1-c1ccc(F)c(Cl)c1.
What is the InChIKey of 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate?
The InChIKey is OXBGRFUOVQJYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClFN4O2/c1-12-17(18(25)26-10-2-3-13-6-8-21-9-7-13)22-23-24(12)14-4-5-16(20)15(19)11-14/h4-9,11H,2-3,10H2,1H3.
What are the key properties of 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate?
3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate has a molecular weight of 374.80 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-ylpropyl 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylate is sourced from PubChem (CID 166199225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).