C18H13F4N3O2 — CID 166200461
N-[2-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]quinoline-5-carboxamide (PubChem CID 166200461) has the molecular formula C18H13F4N3O2 and a molecular weight of 379.31 g/mol. Its IUPAC name is N-[2-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]quinoline-5-carboxamide.
| Compound Name | N-[2-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 166200461 |
| Molecular Formula | C18H13F4N3O2 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[2-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]quinoline-5-carboxamide |
| SMILES | O=C(Nc1ccnc(OCC(F)(F)C(F)F)c1)c1cccc2ncccc12 |
| InChI | InChI=1S/C18H13F4N3O2/c19-17(20)18(21,22)10-27-15-9-11(6-8-24-15)25-16(26)13-3-1-5-14-12(13)4-2-7-23-14/h1-9,17H,10H2,(H,24,25,26) |
| InChIKey | YHYZSCGXHDTCOC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|