About N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine
N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 166200922) has the molecular formula C14H13N7S
and a molecular weight of 311.37 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 166200922 |
| Molecular Formula | C14H13N7S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CC(Cc1nc2ccccc2s1)Nc1ccc2nnnn2n1 |
| InChI | InChI=1S/C14H13N7S/c1-9(8-14-16-10-4-2-3-5-11(10)22-14)15-12-6-7-13-17-19-20-21(13)18-12/h2-7,9H,8H2,1H3,(H,15,18) |
| InChIKey | IWIKJPFQYGUZKQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine (CID 166200922) is N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine is CC(Cc1nc2ccccc2s1)Nc1ccc2nnnn2n1.
What is the InChIKey of N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is IWIKJPFQYGUZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N7S/c1-9(8-14-16-10-4-2-3-5-11(10)22-14)15-12-6-7-13-17-19-20-21(13)18-12/h2-7,9H,8H2,1H3,(H,15,18).
What are the key properties of N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine?
N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 311.37 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 166200922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).