C17H20N4O2S — CID 166201009
4-acetyl-N-[(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]thiophene-2-carboxamide (PubChem CID 166201009) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-acetyl-N-[(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 4-acetyl-N-[(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 166201009 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-acetyl-N-[(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1csc(C(=O)NCc2cc(C)nc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C17H20N4O2S/c1-11-7-14(20-17(19-11)21-5-3-4-6-21)9-18-16(23)15-8-13(10-24-15)12(2)22/h7-8,10H,3-6,9H2,1-2H3,(H,18,23) |
| InChIKey | GAFVSPNLFBRZKK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |