About 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine
5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 166201249) has the molecular formula C17H15N3S
and a molecular weight of 293.40 g/mol. Its IUPAC name is 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| PubChem CID | 166201249 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | c1ccc(-c2cncc(N3CCc4sccc4C3)n2)cc1 |
| InChI | InChI=1S/C17H15N3S/c1-2-4-13(5-3-1)15-10-18-11-17(19-15)20-8-6-16-14(12-20)7-9-21-16/h1-5,7,9-11H,6,8,12H2 |
| InChIKey | BCHNZEJBKULXOJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The IUPAC name of 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine (CID 166201249) is 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine.
What is the SMILES notation for 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The canonical SMILES for 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine is c1ccc(-c2cncc(N3CCc4sccc4C3)n2)cc1.
What is the InChIKey of 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The InChIKey is BCHNZEJBKULXOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3S/c1-2-4-13(5-3-1)15-10-18-11-17(19-15)20-8-6-16-14(12-20)7-9-21-16/h1-5,7,9-11H,6,8,12H2.
What are the key properties of 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine?
5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine has a molecular weight of 293.40 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-phenylpyrazin-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine is sourced from PubChem (CID 166201249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).