C18H14Cl2FN3OS — CID 16620142
3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazole (PubChem CID 16620142) has the molecular formula C18H14Cl2FN3OS and a molecular weight of 410.30 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazole.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 16620142 |
| Molecular Formula | C18H14Cl2FN3OS |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-[(E)-2-(4-fluorophenyl)ethenyl]-1H-1,2,4-triazole |
| SMILES | Fc1ccc(/C=C/c2nc(SCCOc3ccc(Cl)cc3Cl)n[nH]2)cc1 |
| InChI | InChI=1S/C18H14Cl2FN3OS/c19-13-4-7-16(15(20)11-13)25-9-10-26-18-22-17(23-24-18)8-3-12-1-5-14(21)6-2-12/h1-8,11H,9-10H2,(H,22,23,24)/b8-3+ |
| InChIKey | GCVJOZAOMZIVMS-FPYGCLRLSA-N |
| XLogP | 5.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|