About (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate
(3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate (PubChem CID 166201861) has the molecular formula C20H15N3O4S2
and a molecular weight of 425.49 g/mol. Its IUPAC name is (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate.
Molecular Properties
| Compound Name | (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate |
| PubChem CID | 166201861 |
| Molecular Formula | C20H15N3O4S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate |
| SMILES | O=C(CSCc1cc(=O)n2ccsc2n1)Oc1cccc(Oc2cccnc2)c1 |
| InChI | InChI=1S/C20H15N3O4S2/c24-18-9-14(22-20-23(18)7-8-29-20)12-28-13-19(25)27-16-4-1-3-15(10-16)26-17-5-2-6-21-11-17/h1-11H,12-13H2 |
| InChIKey | NXJYIDNQSXSNOM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate?
The IUPAC name of (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate (CID 166201861) is (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate.
What is the SMILES notation for (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate?
The canonical SMILES for (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate is O=C(CSCc1cc(=O)n2ccsc2n1)Oc1cccc(Oc2cccnc2)c1.
What is the InChIKey of (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate?
The InChIKey is NXJYIDNQSXSNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O4S2/c24-18-9-14(22-20-23(18)7-8-29-20)12-28-13-19(25)27-16-4-1-3-15(10-16)26-17-5-2-6-21-11-17/h1-11H,12-13H2.
What are the key properties of (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate?
(3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate has a molecular weight of 425.49 g/mol, XLogP of 3.78, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate is sourced from PubChem (CID 166201861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).