C20H15N3O4S2 — CID 166201861
(3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate (PubChem CID 166201861) has the molecular formula C20H15N3O4S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate.
| Compound Name | (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 166201861 |
| Molecular Formula | C20H15N3O4S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | (3-pyridin-3-yloxyphenyl) 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methylsulfanyl]acetate |
| SMILES | O=C(CSCc1cc(=O)n2ccsc2n1)Oc1cccc(Oc2cccnc2)c1 |
| InChI | InChI=1S/C20H15N3O4S2/c24-18-9-14(22-20-23(18)7-8-29-20)12-28-13-19(25)27-16-4-1-3-15(10-16)26-17-5-2-6-21-11-17/h1-11H,12-13H2 |
| InChIKey | NXJYIDNQSXSNOM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|