C27H36N4O2 — CID 166202837
1,7-bis(3,3-dimethyl-2-pyridin-4-ylazetidin-1-yl)heptane-1,7-dione (PubChem CID 166202837) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 1,7-bis(3,3-dimethyl-2-pyridin-4-ylazetidin-1-yl)heptane-1,7-dione.
| Compound Name | 1,7-bis(3,3-dimethyl-2-pyridin-4-ylazetidin-1-yl)heptane-1,7-dione |
|---|---|
| PubChem CID | 166202837 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1,7-bis(3,3-dimethyl-2-pyridin-4-ylazetidin-1-yl)heptane-1,7-dione |
| SMILES | CC1(C)CN(C(=O)CCCCCC(=O)N2CC(C)(C)C2c2ccncc2)C1c1ccncc1 |
| InChI | InChI=1S/C27H36N4O2/c1-26(2)18-30(24(26)20-10-14-28-15-11-20)22(32)8-6-5-7-9-23(33)31-19-27(3,4)25(31)21-12-16-29-17-13-21/h10-17,24-25H,5-9,18-19H2,1-4H3 |
| InChIKey | HECFDHYURUEDQY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|