About N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine
N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 166203101) has the molecular formula C10H8N6
and a molecular weight of 212.22 g/mol. Its IUPAC name is N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine.
Molecular Properties
| Compound Name | N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine |
| PubChem CID | 166203101 |
| Molecular Formula | C10H8N6 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | c1cnc2nc(Nc3cn[nH]c3)ccc2n1 |
| InChI | InChI=1S/C10H8N6/c1-2-9(15-7-5-13-14-6-7)16-10-8(1)11-3-4-12-10/h1-6H,(H,13,14)(H,12,15,16) |
| InChIKey | JLZJSVQNYUNQDA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine?
The IUPAC name of N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine (CID 166203101) is N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine.
What is the SMILES notation for N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine?
The canonical SMILES for N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine is c1cnc2nc(Nc3cn[nH]c3)ccc2n1.
What is the InChIKey of N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine?
The InChIKey is JLZJSVQNYUNQDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N6/c1-2-9(15-7-5-13-14-6-7)16-10-8(1)11-3-4-12-10/h1-6H,(H,13,14)(H,12,15,16).
What are the key properties of N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine?
N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine has a molecular weight of 212.22 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-pyrazol-4-yl)pyrido[2,3-b]pyrazin-6-amine is sourced from PubChem (CID 166203101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).