C21H22N2O3 — CID 166203540
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-benzylbutanoate (PubChem CID 166203540) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-benzylbutanoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-benzylbutanoate |
|---|---|
| PubChem CID | 166203540 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-benzylbutanoate |
| SMILES | CCC(Cc1ccccc1)C(=O)OCc1cc(=O)n2cc(C)ccc2n1 |
| InChI | InChI=1S/C21H22N2O3/c1-3-17(11-16-7-5-4-6-8-16)21(25)26-14-18-12-20(24)23-13-15(2)9-10-19(23)22-18/h4-10,12-13,17H,3,11,14H2,1-2H3 |
| InChIKey | JYHUQDGESYZPLB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |