C22H20N4O5S — CID 166204063
4-[2,5-dimethyl-3-[2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetyl]pyrrol-1-yl]benzenesulfonamide (PubChem CID 166204063) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is 4-[2,5-dimethyl-3-[2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetyl]pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2,5-dimethyl-3-[2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetyl]pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 166204063 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-[2,5-dimethyl-3-[2-(5-oxo-3-phenyl-1,2,4-oxadiazol-4-yl)acetyl]pyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(C(=O)Cn2c(-c3ccccc3)noc2=O)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H20N4O5S/c1-14-12-19(15(2)26(14)17-8-10-18(11-9-17)32(23,29)30)20(27)13-25-21(24-31-22(25)28)16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H2,23,29,30) |
| InChIKey | QZUYEJFQEVHPTP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|