C18H18ClN5S — CID 166205511
2-(3-chlorophenyl)-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 166205511) has the molecular formula C18H18ClN5S and a molecular weight of 371.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-(3-chlorophenyl)-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 166205511 |
| Molecular Formula | C18H18ClN5S |
| Molecular Weight | 371.90 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | Cc1nnc(CNc2nc(-c3cccc(Cl)c3)nc3c2CCCC3)s1 |
| InChI | InChI=1S/C18H18ClN5S/c1-11-23-24-16(25-11)10-20-18-14-7-2-3-8-15(14)21-17(22-18)12-5-4-6-13(19)9-12/h4-6,9H,2-3,7-8,10H2,1H3,(H,20,21,22) |
| InChIKey | GYAFKCVBCBIMBB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |