About 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate
2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate (PubChem CID 166205810) has the molecular formula C18H25N3O5
and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate |
| PubChem CID | 166205810 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate |
| SMILES | COC(=O)c1cnc(C(=O)OCC(=O)N(C(C)C)C2CCCCC2)cn1 |
| InChI | InChI=1S/C18H25N3O5/c1-12(2)21(13-7-5-4-6-8-13)16(22)11-26-18(24)15-10-19-14(9-20-15)17(23)25-3/h9-10,12-13H,4-8,11H2,1-3H3 |
| InChIKey | DXDJHCAAXKTTGR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate?
The IUPAC name of 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate (CID 166205810) is 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate.
What is the SMILES notation for 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate?
The canonical SMILES for 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate is COC(=O)c1cnc(C(=O)OCC(=O)N(C(C)C)C2CCCCC2)cn1.
What is the InChIKey of 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate?
The InChIKey is DXDJHCAAXKTTGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O5/c1-12(2)21(13-7-5-4-6-8-13)16(22)11-26-18(24)15-10-19-14(9-20-15)17(23)25-3/h9-10,12-13H,4-8,11H2,1-3H3.
What are the key properties of 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate?
2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate has a molecular weight of 363.41 g/mol, XLogP of 1.99, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[2-[cyclohexyl(propan-2-yl)amino]-2-oxoethyl] 5-O-methyl pyrazine-2,5-dicarboxylate is sourced from PubChem (CID 166205810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).