C23H22ClN5O4S — CID 166206124
2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenoxy]-N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]acetamide (PubChem CID 166206124) has the molecular formula C23H22ClN5O4S and a molecular weight of 499.98 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenoxy]-N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]acetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenoxy]-N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 166206124 |
| Molecular Formula | C23H22ClN5O4S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenoxy]-N-[2-[(5-cyano-2-pyridinyl)amino]ethyl]acetamide |
| SMILES | CN(c1ccc(OCC(=O)NCCNc2ccc(C#N)cn2)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClN5O4S/c1-29(34(31,32)21-9-3-18(24)4-10-21)19-5-7-20(8-6-19)33-16-23(30)27-13-12-26-22-11-2-17(14-25)15-28-22/h2-11,15H,12-13,16H2,1H3,(H,26,28)(H,27,30) |
| InChIKey | XUKNMYMRXDWHSJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|