About [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate
[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 166206239) has the molecular formula C20H15FN2O3S
and a molecular weight of 382.42 g/mol. Its IUPAC name is [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
| PubChem CID | 166206239 |
| Molecular Formula | C20H15FN2O3S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | Cc1ccc(-c2nnc(COC(=O)c3sc4cccc(F)c4c3C)o2)cc1 |
| InChI | InChI=1S/C20H15FN2O3S/c1-11-6-8-13(9-7-11)19-23-22-16(26-19)10-25-20(24)18-12(2)17-14(21)4-3-5-15(17)27-18/h3-9H,10H2,1-2H3 |
| InChIKey | VWLZMBXBWRPYFP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate?
The IUPAC name of [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate (CID 166206239) is [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate.
What is the SMILES notation for [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate?
The canonical SMILES for [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate is Cc1ccc(-c2nnc(COC(=O)c3sc4cccc(F)c4c3C)o2)cc1.
What is the InChIKey of [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate?
The InChIKey is VWLZMBXBWRPYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN2O3S/c1-11-6-8-13(9-7-11)19-23-22-16(26-19)10-25-20(24)18-12(2)17-14(21)4-3-5-15(17)27-18/h3-9H,10H2,1-2H3.
What are the key properties of [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate?
[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate has a molecular weight of 382.42 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 166206239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).