C10H11F2NO — CID 166206862
N-[(2,6-difluorophenyl)methyl]-N-methylacetamide (PubChem CID 166206862) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-N-methylacetamide.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 166206862 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)Cc1c(F)cccc1F |
| InChI | InChI=1S/C10H11F2NO/c1-7(14)13(2)6-8-9(11)4-3-5-10(8)12/h3-5H,6H2,1-2H3 |
| InChIKey | OZVYEWCEXHKMEU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |