C18H20N4O — CID 166207351
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(quinolin-2-ylmethyl)propanamide (PubChem CID 166207351) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(quinolin-2-ylmethyl)propanamide.
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(quinolin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 166207351 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(quinolin-2-ylmethyl)propanamide |
| SMILES | Cc1n[nH]c(C)c1CCC(=O)NCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H20N4O/c1-12-16(13(2)22-21-12)9-10-18(23)19-11-15-8-7-14-5-3-4-6-17(14)20-15/h3-8H,9-11H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | UKCWONQZOBHSGK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |