C22H24N4O3S — CID 166208605
N-[2-[(5E)-5-[(4-tert-butylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylpyrimidine-5-carboxamide (PubChem CID 166208605) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-tert-butylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylpyrimidine-5-carboxamide.
| Compound Name | N-[2-[(5E)-5-[(4-tert-butylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 166208605 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[2-[(5E)-5-[(4-tert-butylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1ncncc1C(=O)NCCN1C(=O)S/C(=C/c2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C22H24N4O3S/c1-14-17(12-23-13-25-14)19(27)24-9-10-26-20(28)18(30-21(26)29)11-15-5-7-16(8-6-15)22(2,3)4/h5-8,11-13H,9-10H2,1-4H3,(H,24,27)/b18-11+ |
| InChIKey | OXNXIIVDSHBYEE-WOJGMQOQSA-N |
| XLogP | 3.55 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|