About 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one
3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one (PubChem CID 166208775) has the molecular formula C18H16N6O3S
and a molecular weight of 396.43 g/mol. Its IUPAC name is 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one |
| PubChem CID | 166208775 |
| Molecular Formula | C18H16N6O3S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1CCCSc1nnnn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16N6O3S/c25-17-19-13-4-1-2-5-14(13)23(17)8-3-9-28-18-20-21-22-24(18)12-6-7-15-16(10-12)27-11-26-15/h1-2,4-7,10H,3,8-9,11H2,(H,19,25) |
| InChIKey | QFVCRRFKDZCKSX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one?
The IUPAC name of 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one (CID 166208775) is 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one.
What is the SMILES notation for 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one?
The canonical SMILES for 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one is O=c1[nH]c2ccccc2n1CCCSc1nnnn1-c1ccc2c(c1)OCO2.
What is the InChIKey of 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one?
The InChIKey is QFVCRRFKDZCKSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O3S/c25-17-19-13-4-1-2-5-14(13)23(17)8-3-9-28-18-20-21-22-24(18)12-6-7-15-16(10-12)27-11-26-15/h1-2,4-7,10H,3,8-9,11H2,(H,19,25).
What are the key properties of 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one?
3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one has a molecular weight of 396.43 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanylpropyl]-1H-benzimidazol-2-one is sourced from PubChem (CID 166208775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).