C14H13N7O2 — CID 166209656
3-imidazol-1-yl-N'-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)benzohydrazide (PubChem CID 166209656) has the molecular formula C14H13N7O2 and a molecular weight of 311.31 g/mol. Its IUPAC name is 3-imidazol-1-yl-N'-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)benzohydrazide.
| Compound Name | 3-imidazol-1-yl-N'-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)benzohydrazide |
|---|---|
| PubChem CID | 166209656 |
| Molecular Formula | C14H13N7O2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-imidazol-1-yl-N'-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)benzohydrazide |
| SMILES | Cc1nnc(NNC(=O)c2cccc(-n3ccnc3)c2)[nH]c1=O |
| InChI | InChI=1S/C14H13N7O2/c1-9-12(22)16-14(19-17-9)20-18-13(23)10-3-2-4-11(7-10)21-6-5-15-8-21/h2-8H,1H3,(H,18,23)(H2,16,19,20,22) |
| InChIKey | HTJVRDSJJHIDLS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|