C20H20N4O2 — CID 16620986
3-(4-benzylpiperazine-1-carbonyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 16620986) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-(4-benzylpiperazine-1-carbonyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(4-benzylpiperazine-1-carbonyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 16620986 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-(4-benzylpiperazine-1-carbonyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=C(c1cnc2ccccn2c1=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N4O2/c25-19(17-14-21-18-8-4-5-9-24(18)20(17)26)23-12-10-22(11-13-23)15-16-6-2-1-3-7-16/h1-9,14H,10-13,15H2 |
| InChIKey | QVFIICJQUGNGRV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |