C19H19N5O3S — CID 166210473
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[1-(1-methylbenzimidazol-2-yl)ethyl]acetamide (PubChem CID 166210473) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[1-(1-methylbenzimidazol-2-yl)ethyl]acetamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[1-(1-methylbenzimidazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 166210473 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[1-(1-methylbenzimidazol-2-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)C/N=C1\NS(=O)(=O)c2ccccc21)c1nc2ccccc2n1C |
| InChI | InChI=1S/C19H19N5O3S/c1-12(19-22-14-8-4-5-9-15(14)24(19)2)21-17(25)11-20-18-13-7-3-6-10-16(13)28(26,27)23-18/h3-10,12H,11H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | GJZXGGGFGYSQSY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|