C19H16N4O3 — CID 166210692
2-cyano-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)propanamide (PubChem CID 166210692) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-cyano-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)propanamide.
| Compound Name | 2-cyano-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 166210692 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-cyano-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)propanamide |
| SMILES | CC(C#N)C(=O)NN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H16N4O3/c1-13(12-20)16(24)22-23-17(25)19(21-18(23)26,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13H,1H3,(H,21,26)(H,22,24) |
| InChIKey | OVVBOXUQPCTKNS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|