C13H12ClN3O4S — CID 166210716
3-[[(2-amino-5-chloro-3-pyridinyl)sulfonylamino]methyl]benzoic acid (PubChem CID 166210716) has the molecular formula C13H12ClN3O4S and a molecular weight of 341.78 g/mol. Its IUPAC name is 3-[[(2-amino-5-chloro-3-pyridinyl)sulfonylamino]methyl]benzoic acid.
| Compound Name | 3-[[(2-amino-5-chloro-3-pyridinyl)sulfonylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 166210716 |
| Molecular Formula | C13H12ClN3O4S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 3-[[(2-amino-5-chloro-3-pyridinyl)sulfonylamino]methyl]benzoic acid |
| SMILES | Nc1ncc(Cl)cc1S(=O)(=O)NCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C13H12ClN3O4S/c14-10-5-11(12(15)16-7-10)22(20,21)17-6-8-2-1-3-9(4-8)13(18)19/h1-5,7,17H,6H2,(H2,15,16)(H,18,19) |
| InChIKey | SHKSXDWMJOJVTK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |