C11H14N2O5S — CID 166210769
N-(2-amino-2-oxoethyl)sulfonyl-2-(4-methoxyphenyl)acetamide (PubChem CID 166210769) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)sulfonyl-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-(2-amino-2-oxoethyl)sulfonyl-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 166210769 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-(2-amino-2-oxoethyl)sulfonyl-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NS(=O)(=O)CC(N)=O)cc1 |
| InChI | InChI=1S/C11H14N2O5S/c1-18-9-4-2-8(3-5-9)6-11(15)13-19(16,17)7-10(12)14/h2-5H,6-7H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | HNDQAHDKLQIYGX-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |