C10H15N3O2 — CID 166211162
1-[2-(1,2,4-oxadiazol-3-yl)piperidin-1-yl]propan-1-one (PubChem CID 166211162) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-[2-(1,2,4-oxadiazol-3-yl)piperidin-1-yl]propan-1-one.
| Compound Name | 1-[2-(1,2,4-oxadiazol-3-yl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 166211162 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-[2-(1,2,4-oxadiazol-3-yl)piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCCC1c1ncon1 |
| InChI | InChI=1S/C10H15N3O2/c1-2-9(14)13-6-4-3-5-8(13)10-11-7-15-12-10/h7-8H,2-6H2,1H3 |
| InChIKey | RTBAQUZWGCNYIC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |