C17H17ClN4 — CID 166211654
N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-N-methyl-1-pyridin-4-ylmethanamine (PubChem CID 166211654) has the molecular formula C17H17ClN4 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-N-methyl-1-pyridin-4-ylmethanamine.
| Compound Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-N-methyl-1-pyridin-4-ylmethanamine |
|---|---|
| PubChem CID | 166211654 |
| Molecular Formula | C17H17ClN4 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]-N-methyl-1-pyridin-4-ylmethanamine |
| SMILES | CN(Cc1ccncc1)Cc1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN4/c1-22(11-13-6-8-19-9-7-13)12-15-10-20-21-17(15)14-2-4-16(18)5-3-14/h2-10H,11-12H2,1H3,(H,20,21) |
| InChIKey | JUJLLERTQZLCOK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |