C22H22N2O5S — CID 166211681
N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-7-methoxy-3,4-dihydronaphthalene-2-sulfonamide (PubChem CID 166211681) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-7-methoxy-3,4-dihydronaphthalene-2-sulfonamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-7-methoxy-3,4-dihydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 166211681 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-3-yl)methyl]phenyl]-7-methoxy-3,4-dihydronaphthalene-2-sulfonamide |
| SMILES | COc1ccc2c(c1)C=C(S(=O)(=O)Nc1ccc(CC3CC(=O)NC3=O)cc1)CC2 |
| InChI | InChI=1S/C22H22N2O5S/c1-29-19-8-4-15-5-9-20(12-16(15)11-19)30(27,28)24-18-6-2-14(3-7-18)10-17-13-21(25)23-22(17)26/h2-4,6-8,11-12,17,24H,5,9-10,13H2,1H3,(H,23,25,26) |
| InChIKey | CVIZYAOONLVREF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|