About N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide
N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 166211949) has the molecular formula C17H16N4OS
and a molecular weight of 324.41 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 166211949 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1csc(-c2cccc(C(=O)N(CCC#N)CCC#N)c2)n1 |
| InChI | InChI=1S/C17H16N4OS/c1-13-12-23-16(20-13)14-5-2-6-15(11-14)17(22)21(9-3-7-18)10-4-8-19/h2,5-6,11-12H,3-4,9-10H2,1H3 |
| InChIKey | IDFFJEAAWNIFGK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide (CID 166211949) is N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide is Cc1csc(-c2cccc(C(=O)N(CCC#N)CCC#N)c2)n1.
What is the InChIKey of N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is IDFFJEAAWNIFGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4OS/c1-13-12-23-16(20-13)14-5-2-6-15(11-14)17(22)21(9-3-7-18)10-4-8-19/h2,5-6,11-12H,3-4,9-10H2,1H3.
What are the key properties of N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide?
N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 324.41 g/mol, XLogP of 3.39, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-cyanoethyl)-3-(4-methyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 166211949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).