C13H15N3O3 — CID 166212805
oxan-3-ylmethyl [1,2,4]triazolo[4,3-a]pyridine-6-carboxylate (PubChem CID 166212805) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is oxan-3-ylmethyl [1,2,4]triazolo[4,3-a]pyridine-6-carboxylate.
| Compound Name | oxan-3-ylmethyl [1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 166212805 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | oxan-3-ylmethyl [1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
| SMILES | O=C(OCC1CCCOC1)c1ccc2nncn2c1 |
| InChI | InChI=1S/C13H15N3O3/c17-13(19-8-10-2-1-5-18-7-10)11-3-4-12-15-14-9-16(12)6-11/h3-4,6,9-10H,1-2,5,7-8H2 |
| InChIKey | FRMTXNMLMGQYML-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |