C16H15IN4O — CID 16621285
N-(3-iodophenyl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 16621285) has the molecular formula C16H15IN4O and a molecular weight of 406.23 g/mol. Its IUPAC name is N-(3-iodophenyl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | N-(3-iodophenyl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 16621285 |
| Molecular Formula | C16H15IN4O |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | N-(3-iodophenyl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(I)c2)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C16H15IN4O/c1-9-7-13(14-10(2)20-21(3)15(14)18-9)16(22)19-12-6-4-5-11(17)8-12/h4-8H,1-3H3,(H,19,22) |
| InChIKey | GCSMPCKPQFRIHB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|