C18H13F3N2O3S — CID 166212983
2-(3,4-dimethoxyphenyl)-N-(3,4,5-trifluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 166212983) has the molecular formula C18H13F3N2O3S and a molecular weight of 394.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(3,4,5-trifluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(3,4,5-trifluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166212983 |
| Molecular Formula | C18H13F3N2O3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(3,4,5-trifluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(-c2nc(C(=O)Nc3cc(F)c(F)c(F)c3)cs2)cc1OC |
| InChI | InChI=1S/C18H13F3N2O3S/c1-25-14-4-3-9(5-15(14)26-2)18-23-13(8-27-18)17(24)22-10-6-11(19)16(21)12(20)7-10/h3-8H,1-2H3,(H,22,24) |
| InChIKey | NULWMLNWLRGSGV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|