C18H20N2O4S — CID 166213016
4-[4-(pyridin-3-ylmethyl)piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 166213016) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-[4-(pyridin-3-ylmethyl)piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-[4-(pyridin-3-ylmethyl)piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 166213016 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-[4-(pyridin-3-ylmethyl)piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCC(Cc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c21-18(22)16-3-5-17(6-4-16)25(23,24)20-10-7-14(8-11-20)12-15-2-1-9-19-13-15/h1-6,9,13-14H,7-8,10-12H2,(H,21,22) |
| InChIKey | UIHKLPCKWSRZEE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |