C17H12F3N3O2 — CID 166213399
N-phenyl-4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzamide (PubChem CID 166213399) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is N-phenyl-4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzamide.
| Compound Name | N-phenyl-4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 166213399 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-phenyl-4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]benzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(-c2nc(CC(F)(F)F)no2)cc1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)10-14-22-16(25-23-14)12-8-6-11(7-9-12)15(24)21-13-4-2-1-3-5-13/h1-9H,10H2,(H,21,24) |
| InChIKey | YSXCLPRHRVQKRP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |