C24H21ClN4O3 — CID 166213729
N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-6-(pyrrolidine-1-carbonyl)pyridine-2-carboxamide (PubChem CID 166213729) has the molecular formula C24H21ClN4O3 and a molecular weight of 448.91 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-6-(pyrrolidine-1-carbonyl)pyridine-2-carboxamide.
| Compound Name | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-6-(pyrrolidine-1-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166213729 |
| Molecular Formula | C24H21ClN4O3 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-6-(pyrrolidine-1-carbonyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)Nc1ccc(Cl)cc1)c1cccc(C(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C24H21ClN4O3/c25-16-10-12-17(13-11-16)26-22(30)18-6-1-2-7-19(18)28-23(31)20-8-5-9-21(27-20)24(32)29-14-3-4-15-29/h1-2,5-13H,3-4,14-15H2,(H,26,30)(H,28,31) |
| InChIKey | PIEBRGIOYLHYEZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |