About 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one
6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 166214244) has the molecular formula C18H17N7O
and a molecular weight of 347.38 g/mol. Its IUPAC name is 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 166214244 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cn1nc(Nc2nc3c(cnn3-c3ccccc3)c(=O)[nH]2)cc1C1CC1 |
| InChI | InChI=1S/C18H17N7O/c1-24-14(11-7-8-11)9-15(23-24)20-18-21-16-13(17(26)22-18)10-19-25(16)12-5-3-2-4-6-12/h2-6,9-11H,7-8H2,1H3,(H2,20,21,22,23,26) |
| InChIKey | UFNLLBXIWRFFFU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 166214244) is 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is Cn1nc(Nc2nc3c(cnn3-c3ccccc3)c(=O)[nH]2)cc1C1CC1.
What is the InChIKey of 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is UFNLLBXIWRFFFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N7O/c1-24-14(11-7-8-11)9-15(23-24)20-18-21-16-13(17(26)22-18)10-19-25(16)12-5-3-2-4-6-12/h2-6,9-11H,7-8H2,1H3,(H2,20,21,22,23,26).
What are the key properties of 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one?
6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 347.38 g/mol, XLogP of 2.46, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-cyclopropyl-1-methylpyrazol-3-yl)amino]-1-phenyl-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 166214244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).