C13H14F3N5O — CID 16621531
2-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-prop-2-enylacetamide (PubChem CID 16621531) has the molecular formula C13H14F3N5O and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 16621531 |
| Molecular Formula | C13H14F3N5O |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cc1c(C)nc2nc(C(F)(F)F)nn2c1C |
| InChI | InChI=1S/C13H14F3N5O/c1-4-5-17-10(22)6-9-7(2)18-12-19-11(13(14,15)16)20-21(12)8(9)3/h4H,1,5-6H2,2-3H3,(H,17,22) |
| InChIKey | ILOVJYOTNNVWAP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|