C16H15N3O2 — CID 166215679
N-[4-(4,5-dimethylimidazol-1-yl)phenyl]furan-3-carboxamide (PubChem CID 166215679) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[4-(4,5-dimethylimidazol-1-yl)phenyl]furan-3-carboxamide.
| Compound Name | N-[4-(4,5-dimethylimidazol-1-yl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 166215679 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[4-(4,5-dimethylimidazol-1-yl)phenyl]furan-3-carboxamide |
| SMILES | Cc1ncn(-c2ccc(NC(=O)c3ccoc3)cc2)c1C |
| InChI | InChI=1S/C16H15N3O2/c1-11-12(2)19(10-17-11)15-5-3-14(4-6-15)18-16(20)13-7-8-21-9-13/h3-10H,1-2H3,(H,18,20) |
| InChIKey | LDCJIEZBZMCHTO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |