C24H30N4O4 — CID 166216514
1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenyl]urea (PubChem CID 166216514) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenyl]urea.
| Compound Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 166216514 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenyl]urea |
| SMILES | CC1(C)NC(=O)N(c2cccc(NC(=O)NCC(O)c3ccc(C(C)(C)C)cc3)c2)C1=O |
| InChI | InChI=1S/C24H30N4O4/c1-23(2,3)16-11-9-15(10-12-16)19(29)14-25-21(31)26-17-7-6-8-18(13-17)28-20(30)24(4,5)27-22(28)32/h6-13,19,29H,14H2,1-5H3,(H,27,32)(H2,25,26,31) |
| InChIKey | CCRFTRBAKSTCFY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|