C24H28N4O2 — CID 166216577
N-[2-(diethylaminomethyl)phenyl]-2-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)-2-oxoacetamide (PubChem CID 166216577) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[2-(diethylaminomethyl)phenyl]-2-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)-2-oxoacetamide.
| Compound Name | N-[2-(diethylaminomethyl)phenyl]-2-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 166216577 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[2-(diethylaminomethyl)phenyl]-2-(3,4-dihydro-1H-pyrazino[1,2-a]indol-2-yl)-2-oxoacetamide |
| SMILES | CCN(CC)Cc1ccccc1NC(=O)C(=O)N1CCn2c(cc3ccccc32)C1 |
| InChI | InChI=1S/C24H28N4O2/c1-3-26(4-2)16-19-10-5-7-11-21(19)25-23(29)24(30)27-13-14-28-20(17-27)15-18-9-6-8-12-22(18)28/h5-12,15H,3-4,13-14,16-17H2,1-2H3,(H,25,29) |
| InChIKey | QGNPDBRLTIOIDX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|